C28H33ClN2O2S — CID 23285220
N-[2-(3-chlorophenyl)-4-(3-phenylpiperidin-1-yl)butyl]-N-methylbenzenesulfonamide (PubChem CID 23285220) has the molecular formula C28H33ClN2O2S and a molecular weight of 497.10 g/mol. Its IUPAC name is N-[2-(3-chlorophenyl)-4-(3-phenylpiperidin-1-yl)butyl]-N-methylbenzenesulfonamide.
| Compound Name | N-[2-(3-chlorophenyl)-4-(3-phenylpiperidin-1-yl)butyl]-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 23285220 |
| Molecular Formula | C28H33ClN2O2S |
| Molecular Weight | 497.10 g/mol |
| Exact Mass | 496.20 |
| IUPAC Name | N-[2-(3-chlorophenyl)-4-(3-phenylpiperidin-1-yl)butyl]-N-methylbenzenesulfonamide |
| SMILES | CN(CC(CCN1CCCC(c2ccccc2)C1)c1cccc(Cl)c1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C28H33ClN2O2S/c1-30(34(32,33)28-15-6-3-7-16-28)21-26(24-12-8-14-27(29)20-24)17-19-31-18-9-13-25(22-31)23-10-4-2-5-11-23/h2-8,10-12,14-16,20,25-26H,9,13,17-19,21-22H2,1H3 |
| InChIKey | BSYOLLNMELLWPP-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.10 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |