C31H37ClN4O6S2 — CID 22893972
(4-nitrophenyl)methyl N-[1-[(3R)-4-[benzenesulfonyl(methyl)amino]-3-thiophen-3-ylbutyl]piperidin-4-yl]-N-prop-2-ynylcarbamate;hydrochloride (PubChem CID 22893972) has the molecular formula C31H37ClN4O6S2 and a molecular weight of 661.25 g/mol. Its IUPAC name is (4-nitrophenyl)methyl N-[1-[(3R)-4-[benzenesulfonyl(methyl)amino]-3-thiophen-3-ylbutyl]piperidin-4-yl]-N-prop-2-ynylcarbamate;hydrochloride.
| Compound Name | (4-nitrophenyl)methyl N-[1-[(3R)-4-[benzenesulfonyl(methyl)amino]-3-thiophen-3-ylbutyl]piperidin-4-yl]-N-prop-2-ynylcarbamate;hydrochloride |
|---|---|
| PubChem CID | 22893972 |
| Molecular Formula | C31H37ClN4O6S2 |
| Molecular Weight | 661.25 g/mol |
| Exact Mass | 660.18 |
| IUPAC Name | (4-nitrophenyl)methyl N-[1-[(3R)-4-[benzenesulfonyl(methyl)amino]-3-thiophen-3-ylbutyl]piperidin-4-yl]-N-prop-2-ynylcarbamate;hydrochloride |
| SMILES | C#CCN(C(=O)OCc1ccc([N+](=O)[O-])cc1)C1CCN(CC[C@@H](CN(C)S(=O)(=O)c2ccccc2)c2ccsc2)CC1.Cl |
| InChI | InChI=1S/C31H36N4O6S2.ClH/c1-3-17-34(31(36)41-23-25-9-11-29(12-10-25)35(37)38)28-14-19-33(20-15-28)18-13-26(27-16-21-42-24-27)22-32(2)43(39,40)30-7-5-4-6-8-30;/h1,4-12,16,21,24,26,28H,13-15,17-20,22-23H2,2H3;1H/t26-;/m0./s1 |
| InChIKey | WKYBFOGCJJCXAH-SNYZSRNZSA-N |
| XLogP | 5.61 |
| TPSA | 113.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.25 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|