C31H40N4O7S2 — CID 3006654
(4-nitrophenyl)methyl N-[1-[(3S)-4-[benzenesulfonyl(methyl)amino]-3-methyl-3-thiophen-3-ylbutyl]piperidin-4-yl]-N-(2-hydroxyethyl)carbamate (PubChem CID 3006654) has the molecular formula C31H40N4O7S2 and a molecular weight of 644.82 g/mol. Its IUPAC name is (4-nitrophenyl)methyl N-[1-[(3S)-4-[benzenesulfonyl(methyl)amino]-3-methyl-3-thiophen-3-ylbutyl]piperidin-4-yl]-N-(2-hydroxyethyl)carbamate.
| Compound Name | (4-nitrophenyl)methyl N-[1-[(3S)-4-[benzenesulfonyl(methyl)amino]-3-methyl-3-thiophen-3-ylbutyl]piperidin-4-yl]-N-(2-hydroxyethyl)carbamate |
|---|---|
| PubChem CID | 3006654 |
| Molecular Formula | C31H40N4O7S2 |
| Molecular Weight | 644.82 g/mol |
| Exact Mass | 644.23 |
| IUPAC Name | (4-nitrophenyl)methyl N-[1-[(3S)-4-[benzenesulfonyl(methyl)amino]-3-methyl-3-thiophen-3-ylbutyl]piperidin-4-yl]-N-(2-hydroxyethyl)carbamate |
| SMILES | CN(C[C@@](C)(CCN1CCC(N(CCO)C(=O)OCc2ccc([N+](=O)[O-])cc2)CC1)c1ccsc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C31H40N4O7S2/c1-31(26-14-21-43-23-26,24-32(2)44(40,41)29-6-4-3-5-7-29)15-18-33-16-12-27(13-17-33)34(19-20-36)30(37)42-22-25-8-10-28(11-9-25)35(38)39/h3-11,14,21,23,27,36H,12-13,15-20,22,24H2,1-2H3/t31-/m1/s1 |
| InChIKey | PETCVLQGJOSIIL-WJOKGBTCSA-N |
| XLogP | 4.72 |
| TPSA | 133.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.82 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|