C30H39N3O6 — CID 22894051
5-methyl-7-[4-[(4-nitrophenyl)methoxycarbonyl-prop-2-enylamino]piperidin-1-yl]-5-phenylheptanoic acid (PubChem CID 22894051) has the molecular formula C30H39N3O6 and a molecular weight of 537.66 g/mol. Its IUPAC name is 5-methyl-7-[4-[(4-nitrophenyl)methoxycarbonyl-prop-2-enylamino]piperidin-1-yl]-5-phenylheptanoic acid.
| Compound Name | 5-methyl-7-[4-[(4-nitrophenyl)methoxycarbonyl-prop-2-enylamino]piperidin-1-yl]-5-phenylheptanoic acid |
|---|---|
| PubChem CID | 22894051 |
| Molecular Formula | C30H39N3O6 |
| Molecular Weight | 537.66 g/mol |
| Exact Mass | 537.28 |
| IUPAC Name | 5-methyl-7-[4-[(4-nitrophenyl)methoxycarbonyl-prop-2-enylamino]piperidin-1-yl]-5-phenylheptanoic acid |
| SMILES | C=CCN(C(=O)OCc1ccc([N+](=O)[O-])cc1)C1CCN(CCC(C)(CCCC(=O)O)c2ccccc2)CC1 |
| InChI | InChI=1S/C30H39N3O6/c1-3-19-32(29(36)39-23-24-11-13-27(14-12-24)33(37)38)26-15-20-31(21-16-26)22-18-30(2,17-7-10-28(34)35)25-8-5-4-6-9-25/h3-6,8-9,11-14,26H,1,7,10,15-23H2,2H3,(H,34,35) |
| InChIKey | DXNCLDHKHHYFEM-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 113.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.66 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|