C30H40N4O6S — CID 18372797
(4-nitrophenyl)methyl N-[1-[[4-[methyl(methylsulfonyl)amino]-2-phenylcyclopentyl]methyl]piperidin-4-yl]-N-prop-2-enylcarbamate (PubChem CID 18372797) has the molecular formula C30H40N4O6S and a molecular weight of 584.74 g/mol. Its IUPAC name is (4-nitrophenyl)methyl N-[1-[[4-[methyl(methylsulfonyl)amino]-2-phenylcyclopentyl]methyl]piperidin-4-yl]-N-prop-2-enylcarbamate.
| Compound Name | (4-nitrophenyl)methyl N-[1-[[4-[methyl(methylsulfonyl)amino]-2-phenylcyclopentyl]methyl]piperidin-4-yl]-N-prop-2-enylcarbamate |
|---|---|
| PubChem CID | 18372797 |
| Molecular Formula | C30H40N4O6S |
| Molecular Weight | 584.74 g/mol |
| Exact Mass | 584.27 |
| IUPAC Name | (4-nitrophenyl)methyl N-[1-[[4-[methyl(methylsulfonyl)amino]-2-phenylcyclopentyl]methyl]piperidin-4-yl]-N-prop-2-enylcarbamate |
| SMILES | C=CCN(C(=O)OCc1ccc([N+](=O)[O-])cc1)C1CCN(CC2CC(N(C)S(C)(=O)=O)CC2c2ccccc2)CC1 |
| InChI | InChI=1S/C30H40N4O6S/c1-4-16-33(30(35)40-22-23-10-12-27(13-11-23)34(36)37)26-14-17-32(18-15-26)21-25-19-28(31(2)41(3,38)39)20-29(25)24-8-6-5-7-9-24/h4-13,25-26,28-29H,1,14-22H2,2-3H3 |
| InChIKey | LQJFGQPOABIOAT-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 113.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.74 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|