C36H50N4O6 — CID 142033194
benzene;2-cyclohexyl-2-[[(3R)-3-[[4-[(4-nitrophenyl)methoxycarbonyl-prop-2-enylamino]piperidin-1-yl]methyl]cyclopentyl]amino]acetic acid (PubChem CID 142033194) has the molecular formula C36H50N4O6 and a molecular weight of 634.82 g/mol. Its IUPAC name is benzene;2-cyclohexyl-2-[[(3R)-3-[[4-[(4-nitrophenyl)methoxycarbonyl-prop-2-enylamino]piperidin-1-yl]methyl]cyclopentyl]amino]acetic acid.
| Compound Name | benzene;2-cyclohexyl-2-[[(3R)-3-[[4-[(4-nitrophenyl)methoxycarbonyl-prop-2-enylamino]piperidin-1-yl]methyl]cyclopentyl]amino]acetic acid |
|---|---|
| PubChem CID | 142033194 |
| Molecular Formula | C36H50N4O6 |
| Molecular Weight | 634.82 g/mol |
| Exact Mass | 634.37 |
| IUPAC Name | benzene;2-cyclohexyl-2-[[(3R)-3-[[4-[(4-nitrophenyl)methoxycarbonyl-prop-2-enylamino]piperidin-1-yl]methyl]cyclopentyl]amino]acetic acid |
| SMILES | C=CCN(C(=O)OCc1ccc([N+](=O)[O-])cc1)C1CCN(C[C@@H]2CCC(NC(C(=O)O)C3CCCCC3)C2)CC1.c1ccccc1 |
| InChI | InChI=1S/C30H44N4O6.C6H6/c1-2-16-33(30(37)40-21-22-9-12-27(13-10-22)34(38)39)26-14-17-32(18-15-26)20-23-8-11-25(19-23)31-28(29(35)36)24-6-4-3-5-7-24;1-2-4-6-5-3-1/h2,9-10,12-13,23-26,28,31H,1,3-8,11,14-21H2,(H,35,36);1-6H/t23-,25?,28?;/m1./s1 |
| InChIKey | BBCNFKIZDCMAMD-CEVIMRQESA-N |
| XLogP | 6.66 |
| TPSA | 125.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.82 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|