C33H45N3O6 — CID 142033710
benzene;3-cyclopropyl-2-[3-[[4-[ethyl-[(4-nitrophenyl)methoxycarbonyl]amino]piperidin-1-yl]methyl]cyclopentyl]propanoic acid (PubChem CID 142033710) has the molecular formula C33H45N3O6 and a molecular weight of 579.74 g/mol. Its IUPAC name is benzene;3-cyclopropyl-2-[3-[[4-[ethyl-[(4-nitrophenyl)methoxycarbonyl]amino]piperidin-1-yl]methyl]cyclopentyl]propanoic acid.
| Compound Name | benzene;3-cyclopropyl-2-[3-[[4-[ethyl-[(4-nitrophenyl)methoxycarbonyl]amino]piperidin-1-yl]methyl]cyclopentyl]propanoic acid |
|---|---|
| PubChem CID | 142033710 |
| Molecular Formula | C33H45N3O6 |
| Molecular Weight | 579.74 g/mol |
| Exact Mass | 579.33 |
| IUPAC Name | benzene;3-cyclopropyl-2-[3-[[4-[ethyl-[(4-nitrophenyl)methoxycarbonyl]amino]piperidin-1-yl]methyl]cyclopentyl]propanoic acid |
| SMILES | CCN(C(=O)OCc1ccc([N+](=O)[O-])cc1)C1CCN(CC2CCC(C(CC3CC3)C(=O)O)C2)CC1.c1ccccc1 |
| InChI | InChI=1S/C27H39N3O6.C6H6/c1-2-29(27(33)36-18-20-6-9-24(10-7-20)30(34)35)23-11-13-28(14-12-23)17-21-5-8-22(15-21)25(26(31)32)16-19-3-4-19;1-2-4-6-5-3-1/h6-7,9-10,19,21-23,25H,2-5,8,11-18H2,1H3,(H,31,32);1-6H |
| InChIKey | YSRSQOPRMVUAPG-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 113.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.74 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|