C31H48N4O6 — CID 142033192
4-methyl-2-[[(3R)-3-[[4-[(4-nitrophenyl)methoxycarbonyl-prop-2-enylamino]piperidin-1-yl]methyl]cyclopentyl]amino]pentanoic acid;prop-1-ene (PubChem CID 142033192) has the molecular formula C31H48N4O6 and a molecular weight of 572.75 g/mol. Its IUPAC name is 4-methyl-2-[[(3R)-3-[[4-[(4-nitrophenyl)methoxycarbonyl-prop-2-enylamino]piperidin-1-yl]methyl]cyclopentyl]amino]pentanoic acid;prop-1-ene.
| Compound Name | 4-methyl-2-[[(3R)-3-[[4-[(4-nitrophenyl)methoxycarbonyl-prop-2-enylamino]piperidin-1-yl]methyl]cyclopentyl]amino]pentanoic acid;prop-1-ene |
|---|---|
| PubChem CID | 142033192 |
| Molecular Formula | C31H48N4O6 |
| Molecular Weight | 572.75 g/mol |
| Exact Mass | 572.36 |
| IUPAC Name | 4-methyl-2-[[(3R)-3-[[4-[(4-nitrophenyl)methoxycarbonyl-prop-2-enylamino]piperidin-1-yl]methyl]cyclopentyl]amino]pentanoic acid;prop-1-ene |
| SMILES | C=CC.C=CCN(C(=O)OCc1ccc([N+](=O)[O-])cc1)C1CCN(C[C@@H]2CCC(NC(CC(C)C)C(=O)O)C2)CC1 |
| InChI | InChI=1S/C28H42N4O6.C3H6/c1-4-13-31(28(35)38-19-21-6-9-25(10-7-21)32(36)37)24-11-14-30(15-12-24)18-22-5-8-23(17-22)29-26(27(33)34)16-20(2)3;1-3-2/h4,6-7,9-10,20,22-24,26,29H,1,5,8,11-19H2,2-3H3,(H,33,34);3H,1H2,2H3/t22-,23?,26?;/m1./s1 |
| InChIKey | IZIFAGGAEREXSA-GXEQRCSZSA-N |
| XLogP | 5.63 |
| TPSA | 125.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.75 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|