C32H44N4O6 — CID 89231015
(4-nitrophenyl)methyl N-[1-[5-(2,2-dimethylpropanoylamino)-3-hydroxy-3-phenylpentyl]piperidin-4-yl]-N-prop-2-enylcarbamate (PubChem CID 89231015) has the molecular formula C32H44N4O6 and a molecular weight of 580.73 g/mol. Its IUPAC name is (4-nitrophenyl)methyl N-[1-[5-(2,2-dimethylpropanoylamino)-3-hydroxy-3-phenylpentyl]piperidin-4-yl]-N-prop-2-enylcarbamate.
| Compound Name | (4-nitrophenyl)methyl N-[1-[5-(2,2-dimethylpropanoylamino)-3-hydroxy-3-phenylpentyl]piperidin-4-yl]-N-prop-2-enylcarbamate |
|---|---|
| PubChem CID | 89231015 |
| Molecular Formula | C32H44N4O6 |
| Molecular Weight | 580.73 g/mol |
| Exact Mass | 580.33 |
| IUPAC Name | (4-nitrophenyl)methyl N-[1-[5-(2,2-dimethylpropanoylamino)-3-hydroxy-3-phenylpentyl]piperidin-4-yl]-N-prop-2-enylcarbamate |
| SMILES | C=CCN(C(=O)OCc1ccc([N+](=O)[O-])cc1)C1CCN(CCC(O)(CCNC(=O)C(C)(C)C)c2ccccc2)CC1 |
| InChI | InChI=1S/C32H44N4O6/c1-5-20-35(30(38)42-24-25-11-13-28(14-12-25)36(40)41)27-15-21-34(22-16-27)23-18-32(39,26-9-7-6-8-10-26)17-19-33-29(37)31(2,3)4/h5-14,27,39H,1,15-24H2,2-4H3,(H,33,37) |
| InChIKey | VNSUQAFOPLQZJW-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 125.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.73 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|