C29H38I2N2O2 — CID 163730201
(4-iodophenyl)methyl N-[1-(6-iodo-3-methyl-3-phenylhexyl)piperidin-4-yl]-N-prop-2-enylcarbamate (PubChem CID 163730201) has the molecular formula C29H38I2N2O2 and a molecular weight of 700.44 g/mol. Its IUPAC name is (4-iodophenyl)methyl N-[1-(6-iodo-3-methyl-3-phenylhexyl)piperidin-4-yl]-N-prop-2-enylcarbamate.
| Compound Name | (4-iodophenyl)methyl N-[1-(6-iodo-3-methyl-3-phenylhexyl)piperidin-4-yl]-N-prop-2-enylcarbamate |
|---|---|
| PubChem CID | 163730201 |
| Molecular Formula | C29H38I2N2O2 |
| Molecular Weight | 700.44 g/mol |
| Exact Mass | 700.10 |
| IUPAC Name | (4-iodophenyl)methyl N-[1-(6-iodo-3-methyl-3-phenylhexyl)piperidin-4-yl]-N-prop-2-enylcarbamate |
| SMILES | C=CCN(C(=O)OCc1ccc(I)cc1)C1CCN(CCC(C)(CCCI)c2ccccc2)CC1 |
| InChI | InChI=1S/C29H38I2N2O2/c1-3-19-33(28(34)35-23-24-10-12-26(31)13-11-24)27-14-20-32(21-15-27)22-17-29(2,16-7-18-30)25-8-5-4-6-9-25/h3-6,8-13,27H,1,7,14-23H2,2H3 |
| InChIKey | KYYHTNWANGSIFO-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.44 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|