C27H42N2O4 — CID 69198204
benzyl N-[4-(6-morpholin-4-ylhexoxy)cyclohexyl]-N-prop-2-enylcarbamate (PubChem CID 69198204) has the molecular formula C27H42N2O4 and a molecular weight of 458.64 g/mol. Its IUPAC name is benzyl N-[4-(6-morpholin-4-ylhexoxy)cyclohexyl]-N-prop-2-enylcarbamate.
| Compound Name | benzyl N-[4-(6-morpholin-4-ylhexoxy)cyclohexyl]-N-prop-2-enylcarbamate |
|---|---|
| PubChem CID | 69198204 |
| Molecular Formula | C27H42N2O4 |
| Molecular Weight | 458.64 g/mol |
| Exact Mass | 458.31 |
| IUPAC Name | benzyl N-[4-(6-morpholin-4-ylhexoxy)cyclohexyl]-N-prop-2-enylcarbamate |
| SMILES | C=CCN(C(=O)OCc1ccccc1)C1CCC(OCCCCCCN2CCOCC2)CC1 |
| InChI | InChI=1S/C27H42N2O4/c1-2-16-29(27(30)33-23-24-10-6-5-7-11-24)25-12-14-26(15-13-25)32-20-9-4-3-8-17-28-18-21-31-22-19-28/h2,5-7,10-11,25-26H,1,3-4,8-9,12-23H2 |
| InChIKey | YEWJSSJLQOROJZ-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.64 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|