C27H33BrF3NO3 — CID 69196066
benzyl N-[4-(6-bromohexoxy)cyclohexyl]-N-[(2,4,5-trifluorophenyl)methyl]carbamate (PubChem CID 69196066) has the molecular formula C27H33BrF3NO3 and a molecular weight of 556.46 g/mol. Its IUPAC name is benzyl N-[4-(6-bromohexoxy)cyclohexyl]-N-[(2,4,5-trifluorophenyl)methyl]carbamate.
| Compound Name | benzyl N-[4-(6-bromohexoxy)cyclohexyl]-N-[(2,4,5-trifluorophenyl)methyl]carbamate |
|---|---|
| PubChem CID | 69196066 |
| Molecular Formula | C27H33BrF3NO3 |
| Molecular Weight | 556.46 g/mol |
| Exact Mass | 555.16 |
| IUPAC Name | benzyl N-[4-(6-bromohexoxy)cyclohexyl]-N-[(2,4,5-trifluorophenyl)methyl]carbamate |
| SMILES | O=C(OCc1ccccc1)N(Cc1cc(F)c(F)cc1F)C1CCC(OCCCCCCBr)CC1 |
| InChI | InChI=1S/C27H33BrF3NO3/c28-14-6-1-2-7-15-34-23-12-10-22(11-13-23)32(18-21-16-25(30)26(31)17-24(21)29)27(33)35-19-20-8-4-3-5-9-20/h3-5,8-9,16-17,22-23H,1-2,6-7,10-15,18-19H2 |
| InChIKey | FMYIGMBOVOJHBC-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.46 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|