C21H22F3NO3 — CID 69197791
benzyl N-(4-hydroxycyclohexyl)-N-[(2,4,5-trifluorophenyl)methyl]carbamate (PubChem CID 69197791) has the molecular formula C21H22F3NO3 and a molecular weight of 393.41 g/mol. Its IUPAC name is benzyl N-(4-hydroxycyclohexyl)-N-[(2,4,5-trifluorophenyl)methyl]carbamate.
| Compound Name | benzyl N-(4-hydroxycyclohexyl)-N-[(2,4,5-trifluorophenyl)methyl]carbamate |
|---|---|
| PubChem CID | 69197791 |
| Molecular Formula | C21H22F3NO3 |
| Molecular Weight | 393.41 g/mol |
| Exact Mass | 393.16 |
| IUPAC Name | benzyl N-(4-hydroxycyclohexyl)-N-[(2,4,5-trifluorophenyl)methyl]carbamate |
| SMILES | O=C(OCc1ccccc1)N(Cc1cc(F)c(F)cc1F)C1CCC(O)CC1 |
| InChI | InChI=1S/C21H22F3NO3/c22-18-11-20(24)19(23)10-15(18)12-25(16-6-8-17(26)9-7-16)21(27)28-13-14-4-2-1-3-5-14/h1-5,10-11,16-17,26H,6-9,12-13H2 |
| InChIKey | XWNAKAJBIIPWAD-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.41 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|