C31H43F3N2O4 — CID 174451347
benzyl N-[4-[2-[ethyl(2-hydroxyethyl)amino]cyclohexyl]hexoxy]-N-[(2,4,5-trifluorophenyl)methyl]carbamate (PubChem CID 174451347) has the molecular formula C31H43F3N2O4 and a molecular weight of 564.69 g/mol. Its IUPAC name is benzyl N-[4-[2-[ethyl(2-hydroxyethyl)amino]cyclohexyl]hexoxy]-N-[(2,4,5-trifluorophenyl)methyl]carbamate.
| Compound Name | benzyl N-[4-[2-[ethyl(2-hydroxyethyl)amino]cyclohexyl]hexoxy]-N-[(2,4,5-trifluorophenyl)methyl]carbamate |
|---|---|
| PubChem CID | 174451347 |
| Molecular Formula | C31H43F3N2O4 |
| Molecular Weight | 564.69 g/mol |
| Exact Mass | 564.32 |
| IUPAC Name | benzyl N-[4-[2-[ethyl(2-hydroxyethyl)amino]cyclohexyl]hexoxy]-N-[(2,4,5-trifluorophenyl)methyl]carbamate |
| SMILES | CCC(CCCON(Cc1cc(F)c(F)cc1F)C(=O)OCc1ccccc1)C1CCCCC1N(CC)CCO |
| InChI | InChI=1S/C31H43F3N2O4/c1-3-24(26-14-8-9-15-30(26)35(4-2)16-17-37)13-10-18-40-36(21-25-19-28(33)29(34)20-27(25)32)31(38)39-22-23-11-6-5-7-12-23/h5-7,11-12,19-20,24,26,30,37H,3-4,8-10,13-18,21-22H2,1-2H3 |
| InChIKey | LQHVPGDIBDDAGQ-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.69 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|