C24H22FNO5 — CID 174403193
2-[(2-fluoro-4-hydroxyphenyl)methyl-phenylmethoxycarbonylamino]-3-phenylpropanoic acid (PubChem CID 174403193) has the molecular formula C24H22FNO5 and a molecular weight of 423.44 g/mol. Its IUPAC name is 2-[(2-fluoro-4-hydroxyphenyl)methyl-phenylmethoxycarbonylamino]-3-phenylpropanoic acid.
| Compound Name | 2-[(2-fluoro-4-hydroxyphenyl)methyl-phenylmethoxycarbonylamino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 174403193 |
| Molecular Formula | C24H22FNO5 |
| Molecular Weight | 423.44 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | 2-[(2-fluoro-4-hydroxyphenyl)methyl-phenylmethoxycarbonylamino]-3-phenylpropanoic acid |
| SMILES | O=C(O)C(Cc1ccccc1)N(Cc1ccc(O)cc1F)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C24H22FNO5/c25-21-14-20(27)12-11-19(21)15-26(24(30)31-16-18-9-5-2-6-10-18)22(23(28)29)13-17-7-3-1-4-8-17/h1-12,14,22,27H,13,15-16H2,(H,28,29) |
| InChIKey | RSLJFRBDYIOWEI-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.44 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |