C25H21NO4 — CID 22062837
bicyclo[2.2.0]hexa-1,3,5-triene;2-[ethynyl(phenylmethoxycarbonyl)amino]-3-phenylpropanoic acid (PubChem CID 22062837) has the molecular formula C25H21NO4 and a molecular weight of 399.45 g/mol. Its IUPAC name is bicyclo[2.2.0]hexa-1,3,5-triene;2-[ethynyl(phenylmethoxycarbonyl)amino]-3-phenylpropanoic acid.
| Compound Name | bicyclo[2.2.0]hexa-1,3,5-triene;2-[ethynyl(phenylmethoxycarbonyl)amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 22062837 |
| Molecular Formula | C25H21NO4 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | bicyclo[2.2.0]hexa-1,3,5-triene;2-[ethynyl(phenylmethoxycarbonyl)amino]-3-phenylpropanoic acid |
| SMILES | C#CN(C(=O)OCc1ccccc1)C(Cc1ccccc1)C(=O)O.c1cc2ccc1-2 |
| InChI | InChI=1S/C19H17NO4.C6H4/c1-2-20(19(23)24-14-16-11-7-4-8-12-16)17(18(21)22)13-15-9-5-3-6-10-15;1-2-6-4-3-5(1)6/h1,3-12,17H,13-14H2,(H,21,22);1-4H |
| InChIKey | AOQKNBNWVJLDQR-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|