C21H22N2O7 — CID 70041413
2-[[[(1S)-4-amino-1-carboxy-4-oxobutyl]-phenylmethoxycarbonylamino]methyl]benzoic acid (PubChem CID 70041413) has the molecular formula C21H22N2O7 and a molecular weight of 414.41 g/mol. Its IUPAC name is 2-[[[(1S)-4-amino-1-carboxy-4-oxobutyl]-phenylmethoxycarbonylamino]methyl]benzoic acid.
| Compound Name | 2-[[[(1S)-4-amino-1-carboxy-4-oxobutyl]-phenylmethoxycarbonylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 70041413 |
| Molecular Formula | C21H22N2O7 |
| Molecular Weight | 414.41 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | 2-[[[(1S)-4-amino-1-carboxy-4-oxobutyl]-phenylmethoxycarbonylamino]methyl]benzoic acid |
| SMILES | NC(=O)CC[C@@H](C(=O)O)N(Cc1ccccc1C(=O)O)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H22N2O7/c22-18(24)11-10-17(20(27)28)23(12-15-8-4-5-9-16(15)19(25)26)21(29)30-13-14-6-2-1-3-7-14/h1-9,17H,10-13H2,(H2,22,24)(H,25,26)(H,27,28)/t17-/m0/s1 |
| InChIKey | MJMKMSFOKLTNTO-KRWDZBQOSA-N |
| XLogP | 2.24 |
| TPSA | 147.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.41 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |