C20H19N3O8 — CID 150657430
2-[[(1S)-4-amino-1-carboxy-4-oxobutyl]-benzylcarbamoyl]-6-nitrobenzoic acid (PubChem CID 150657430) has the molecular formula C20H19N3O8 and a molecular weight of 429.39 g/mol. Its IUPAC name is 2-[[(1S)-4-amino-1-carboxy-4-oxobutyl]-benzylcarbamoyl]-6-nitrobenzoic acid.
| Compound Name | 2-[[(1S)-4-amino-1-carboxy-4-oxobutyl]-benzylcarbamoyl]-6-nitrobenzoic acid |
|---|---|
| PubChem CID | 150657430 |
| Molecular Formula | C20H19N3O8 |
| Molecular Weight | 429.39 g/mol |
| Exact Mass | 429.12 |
| IUPAC Name | 2-[[(1S)-4-amino-1-carboxy-4-oxobutyl]-benzylcarbamoyl]-6-nitrobenzoic acid |
| SMILES | NC(=O)CC[C@@H](C(=O)O)N(Cc1ccccc1)C(=O)c1cccc([N+](=O)[O-])c1C(=O)O |
| InChI | InChI=1S/C20H19N3O8/c21-16(24)10-9-15(19(26)27)22(11-12-5-2-1-3-6-12)18(25)13-7-4-8-14(23(30)31)17(13)20(28)29/h1-8,15H,9-11H2,(H2,21,24)(H,26,27)(H,28,29)/t15-/m0/s1 |
| InChIKey | JDDNDOANTLCCKG-HNNXBMFYSA-N |
| XLogP | 1.65 |
| TPSA | 181.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.39 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|