C28H26N2O5 — CID 68703676
(2S)-5-amino-2-[benzyl-[4-[(E)-3-oxo-3-phenylprop-1-enyl]benzoyl]amino]-5-oxopentanoic acid (PubChem CID 68703676) has the molecular formula C28H26N2O5 and a molecular weight of 470.53 g/mol. Its IUPAC name is (2S)-5-amino-2-[benzyl-[4-[(E)-3-oxo-3-phenylprop-1-enyl]benzoyl]amino]-5-oxopentanoic acid.
| Compound Name | (2S)-5-amino-2-[benzyl-[4-[(E)-3-oxo-3-phenylprop-1-enyl]benzoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 68703676 |
| Molecular Formula | C28H26N2O5 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | (2S)-5-amino-2-[benzyl-[4-[(E)-3-oxo-3-phenylprop-1-enyl]benzoyl]amino]-5-oxopentanoic acid |
| SMILES | NC(=O)CC[C@@H](C(=O)O)N(Cc1ccccc1)C(=O)c1ccc(/C=C/C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H26N2O5/c29-26(32)18-16-24(28(34)35)30(19-21-7-3-1-4-8-21)27(33)23-14-11-20(12-15-23)13-17-25(31)22-9-5-2-6-10-22/h1-15,17,24H,16,18-19H2,(H2,29,32)(H,34,35)/b17-13+/t24-/m0/s1 |
| InChIKey | SJVWGGDQNUGLPO-VRBZIXIWSA-N |
| XLogP | 3.94 |
| TPSA | 117.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|