C33H30N2O5 — CID 87701833
(2S)-5-amino-2-[2-[3-(4-formylphenyl)phenyl]ethyl-(4-phenylbenzoyl)amino]-5-oxopentanoic acid (PubChem CID 87701833) has the molecular formula C33H30N2O5 and a molecular weight of 534.61 g/mol. Its IUPAC name is (2S)-5-amino-2-[2-[3-(4-formylphenyl)phenyl]ethyl-(4-phenylbenzoyl)amino]-5-oxopentanoic acid.
| Compound Name | (2S)-5-amino-2-[2-[3-(4-formylphenyl)phenyl]ethyl-(4-phenylbenzoyl)amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 87701833 |
| Molecular Formula | C33H30N2O5 |
| Molecular Weight | 534.61 g/mol |
| Exact Mass | 534.22 |
| IUPAC Name | (2S)-5-amino-2-[2-[3-(4-formylphenyl)phenyl]ethyl-(4-phenylbenzoyl)amino]-5-oxopentanoic acid |
| SMILES | NC(=O)CC[C@@H](C(=O)O)N(CCc1cccc(-c2ccc(C=O)cc2)c1)C(=O)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C33H30N2O5/c34-31(37)18-17-30(33(39)40)35(32(38)28-15-13-26(14-16-28)25-6-2-1-3-7-25)20-19-23-5-4-8-29(21-23)27-11-9-24(22-36)10-12-27/h1-16,21-22,30H,17-20H2,(H2,34,37)(H,39,40)/t30-/m0/s1 |
| InChIKey | IYBGNPIRRUJCRN-PMERELPUSA-N |
| XLogP | 5.24 |
| TPSA | 117.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.61 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|