C30H32O5 — CID 151610990
2-[2-[4-[3-(4-carboxybutyl)phenyl]phenyl]-2-oxoethyl]-5-phenylpentanoic acid (PubChem CID 151610990) has the molecular formula C30H32O5 and a molecular weight of 472.58 g/mol. Its IUPAC name is 2-[2-[4-[3-(4-carboxybutyl)phenyl]phenyl]-2-oxoethyl]-5-phenylpentanoic acid.
| Compound Name | 2-[2-[4-[3-(4-carboxybutyl)phenyl]phenyl]-2-oxoethyl]-5-phenylpentanoic acid |
|---|---|
| PubChem CID | 151610990 |
| Molecular Formula | C30H32O5 |
| Molecular Weight | 472.58 g/mol |
| Exact Mass | 472.22 |
| IUPAC Name | 2-[2-[4-[3-(4-carboxybutyl)phenyl]phenyl]-2-oxoethyl]-5-phenylpentanoic acid |
| SMILES | O=C(O)CCCCc1cccc(-c2ccc(C(=O)CC(CCCc3ccccc3)C(=O)O)cc2)c1 |
| InChI | InChI=1S/C30H32O5/c31-28(21-27(30(34)35)14-6-11-22-8-2-1-3-9-22)25-18-16-24(17-19-25)26-13-7-12-23(20-26)10-4-5-15-29(32)33/h1-3,7-9,12-13,16-20,27H,4-6,10-11,14-15,21H2,(H,32,33)(H,34,35) |
| InChIKey | QMMIESVRWYLVDG-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.58 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|