C28H32N2O2 — CID 161031506
2-amino-N-methyl-N-[[3-[4-(6-phenylhexanoyl)phenyl]phenyl]methyl]acetamide (PubChem CID 161031506) has the molecular formula C28H32N2O2 and a molecular weight of 428.58 g/mol. Its IUPAC name is 2-amino-N-methyl-N-[[3-[4-(6-phenylhexanoyl)phenyl]phenyl]methyl]acetamide.
| Compound Name | 2-amino-N-methyl-N-[[3-[4-(6-phenylhexanoyl)phenyl]phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 161031506 |
| Molecular Formula | C28H32N2O2 |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.25 |
| IUPAC Name | 2-amino-N-methyl-N-[[3-[4-(6-phenylhexanoyl)phenyl]phenyl]methyl]acetamide |
| SMILES | CN(Cc1cccc(-c2ccc(C(=O)CCCCCc3ccccc3)cc2)c1)C(=O)CN |
| InChI | InChI=1S/C28H32N2O2/c1-30(28(32)20-29)21-23-12-8-13-26(19-23)24-15-17-25(18-16-24)27(31)14-7-3-6-11-22-9-4-2-5-10-22/h2,4-5,8-10,12-13,15-19H,3,6-7,11,14,20-21,29H2,1H3 |
| InChIKey | TZRJHNBQXBVRJR-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|