C19H23N3O3 — CID 70572054
N-[4-[3-[[(2-aminoacetyl)-methylamino]methyl]phenyl]phenyl]-3-hydroxypropanamide (PubChem CID 70572054) has the molecular formula C19H23N3O3 and a molecular weight of 341.41 g/mol. Its IUPAC name is N-[4-[3-[[(2-aminoacetyl)-methylamino]methyl]phenyl]phenyl]-3-hydroxypropanamide.
| Compound Name | N-[4-[3-[[(2-aminoacetyl)-methylamino]methyl]phenyl]phenyl]-3-hydroxypropanamide |
|---|---|
| PubChem CID | 70572054 |
| Molecular Formula | C19H23N3O3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | N-[4-[3-[[(2-aminoacetyl)-methylamino]methyl]phenyl]phenyl]-3-hydroxypropanamide |
| SMILES | CN(Cc1cccc(-c2ccc(NC(=O)CCO)cc2)c1)C(=O)CN |
| InChI | InChI=1S/C19H23N3O3/c1-22(19(25)12-20)13-14-3-2-4-16(11-14)15-5-7-17(8-6-15)21-18(24)9-10-23/h2-8,11,23H,9-10,12-13,20H2,1H3,(H,21,24) |
| InChIKey | BHQQUOWAOQNKKK-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |