C30H27NO3 — CID 11705513
4-[3-[[benzyl(3-phenylpropanoyl)amino]methyl]phenyl]benzoic acid (PubChem CID 11705513) has the molecular formula C30H27NO3 and a molecular weight of 449.55 g/mol. Its IUPAC name is 4-[3-[[benzyl(3-phenylpropanoyl)amino]methyl]phenyl]benzoic acid.
| Compound Name | 4-[3-[[benzyl(3-phenylpropanoyl)amino]methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 11705513 |
| Molecular Formula | C30H27NO3 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | 4-[3-[[benzyl(3-phenylpropanoyl)amino]methyl]phenyl]benzoic acid |
| SMILES | O=C(O)c1ccc(-c2cccc(CN(Cc3ccccc3)C(=O)CCc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C30H27NO3/c32-29(19-14-23-8-3-1-4-9-23)31(21-24-10-5-2-6-11-24)22-25-12-7-13-28(20-25)26-15-17-27(18-16-26)30(33)34/h1-13,15-18,20H,14,19,21-22H2,(H,33,34) |
| InChIKey | ZBUKFKQYDIVVSL-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |