C29H24ClNO3 — CID 11496867
3-[3-[[(4-chlorobenzoyl)-(2-phenylethyl)amino]methyl]phenyl]benzoic acid (PubChem CID 11496867) has the molecular formula C29H24ClNO3 and a molecular weight of 469.97 g/mol. Its IUPAC name is 3-[3-[[(4-chlorobenzoyl)-(2-phenylethyl)amino]methyl]phenyl]benzoic acid.
| Compound Name | 3-[3-[[(4-chlorobenzoyl)-(2-phenylethyl)amino]methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 11496867 |
| Molecular Formula | C29H24ClNO3 |
| Molecular Weight | 469.97 g/mol |
| Exact Mass | 469.14 |
| IUPAC Name | 3-[3-[[(4-chlorobenzoyl)-(2-phenylethyl)amino]methyl]phenyl]benzoic acid |
| SMILES | O=C(O)c1cccc(-c2cccc(CN(CCc3ccccc3)C(=O)c3ccc(Cl)cc3)c2)c1 |
| InChI | InChI=1S/C29H24ClNO3/c30-27-14-12-23(13-15-27)28(32)31(17-16-21-6-2-1-3-7-21)20-22-8-4-9-24(18-22)25-10-5-11-26(19-25)29(33)34/h1-15,18-19H,16-17,20H2,(H,33,34) |
| InChIKey | LGCOJWMLCIHISQ-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.97 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |