C32H30NNaO4 — CID 23663737
sodium 3-[3-[[(4-methoxybenzoyl)-(4-phenylbutyl)amino]methyl]phenyl]benzoate (PubChem CID 23663737) has the molecular formula C32H30NNaO4 and a molecular weight of 515.59 g/mol. Its IUPAC name is sodium 3-[3-[[(4-methoxybenzoyl)-(4-phenylbutyl)amino]methyl]phenyl]benzoate.
| Compound Name | sodium 3-[3-[[(4-methoxybenzoyl)-(4-phenylbutyl)amino]methyl]phenyl]benzoate |
|---|---|
| PubChem CID | 23663737 |
| Molecular Formula | C32H30NNaO4 |
| Molecular Weight | 515.59 g/mol |
| Exact Mass | 515.21 |
| IUPAC Name | sodium 3-[3-[[(4-methoxybenzoyl)-(4-phenylbutyl)amino]methyl]phenyl]benzoate |
| SMILES | COc1ccc(C(=O)N(CCCCc2ccccc2)Cc2cccc(-c3cccc(C(=O)[O-])c3)c2)cc1.[Na+] |
| InChI | InChI=1S/C32H31NO4.Na/c1-37-30-18-16-26(17-19-30)31(34)33(20-6-5-11-24-9-3-2-4-10-24)23-25-12-7-13-27(21-25)28-14-8-15-29(22-28)32(35)36;/h2-4,7-10,12-19,21-22H,5-6,11,20,23H2,1H3,(H,35,36);/q;+1/p-1 |
| InChIKey | KHCLTYBPOCIPHE-UHFFFAOYSA-M |
| XLogP | 2.39 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.59 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|