C30H34NNaO3 — CID 23662255
sodium 3-[3-[[heptan-4-yl(3-phenylpropanoyl)amino]methyl]phenyl]benzoate (PubChem CID 23662255) has the molecular formula C30H34NNaO3 and a molecular weight of 479.60 g/mol. Its IUPAC name is sodium 3-[3-[[heptan-4-yl(3-phenylpropanoyl)amino]methyl]phenyl]benzoate.
| Compound Name | sodium 3-[3-[[heptan-4-yl(3-phenylpropanoyl)amino]methyl]phenyl]benzoate |
|---|---|
| PubChem CID | 23662255 |
| Molecular Formula | C30H34NNaO3 |
| Molecular Weight | 479.60 g/mol |
| Exact Mass | 479.24 |
| IUPAC Name | sodium 3-[3-[[heptan-4-yl(3-phenylpropanoyl)amino]methyl]phenyl]benzoate |
| SMILES | CCCC(CCC)N(Cc1cccc(-c2cccc(C(=O)[O-])c2)c1)C(=O)CCc1ccccc1.[Na+] |
| InChI | InChI=1S/C30H35NO3.Na/c1-3-10-28(11-4-2)31(29(32)19-18-23-12-6-5-7-13-23)22-24-14-8-15-25(20-24)26-16-9-17-27(21-26)30(33)34;/h5-9,12-17,20-21,28H,3-4,10-11,18-19,22H2,1-2H3,(H,33,34);/q;+1/p-1 |
| InChIKey | YBQFXXQZMTWXEC-UHFFFAOYSA-M |
| XLogP | 2.65 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.60 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |