C21H35NO — CID 71106903
N-[(3-methylphenyl)methyl]-N-nonan-5-ylbutanamide (PubChem CID 71106903) has the molecular formula C21H35NO and a molecular weight of 317.52 g/mol. Its IUPAC name is N-[(3-methylphenyl)methyl]-N-nonan-5-ylbutanamide.
| Compound Name | N-[(3-methylphenyl)methyl]-N-nonan-5-ylbutanamide |
|---|---|
| PubChem CID | 71106903 |
| Molecular Formula | C21H35NO |
| Molecular Weight | 317.52 g/mol |
| Exact Mass | 317.27 |
| IUPAC Name | N-[(3-methylphenyl)methyl]-N-nonan-5-ylbutanamide |
| SMILES | CCCCC(CCCC)N(Cc1cccc(C)c1)C(=O)CCC |
| InChI | InChI=1S/C21H35NO/c1-5-8-14-20(15-9-6-2)22(21(23)11-7-3)17-19-13-10-12-18(4)16-19/h10,12-13,16,20H,5-9,11,14-15,17H2,1-4H3 |
| InChIKey | UEMPMISPQISGKI-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.52 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |