C20H31Cl2NO — CID 71106725
N-[(3,4-dichlorophenyl)methyl]-N-nonan-5-ylbutanamide (PubChem CID 71106725) has the molecular formula C20H31Cl2NO and a molecular weight of 372.38 g/mol. Its IUPAC name is N-[(3,4-dichlorophenyl)methyl]-N-nonan-5-ylbutanamide.
| Compound Name | N-[(3,4-dichlorophenyl)methyl]-N-nonan-5-ylbutanamide |
|---|---|
| PubChem CID | 71106725 |
| Molecular Formula | C20H31Cl2NO |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 371.18 |
| IUPAC Name | N-[(3,4-dichlorophenyl)methyl]-N-nonan-5-ylbutanamide |
| SMILES | CCCCC(CCCC)N(Cc1ccc(Cl)c(Cl)c1)C(=O)CCC |
| InChI | InChI=1S/C20H31Cl2NO/c1-4-7-10-17(11-8-5-2)23(20(24)9-6-3)15-16-12-13-18(21)19(22)14-16/h12-14,17H,4-11,15H2,1-3H3 |
| InChIKey | VRPLUKWFRPKNKN-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |