C19H31NO2 — CID 71106716
N-heptan-4-yl-N-[(3-methoxyphenyl)methyl]butanamide (PubChem CID 71106716) has the molecular formula C19H31NO2 and a molecular weight of 305.46 g/mol. Its IUPAC name is N-heptan-4-yl-N-[(3-methoxyphenyl)methyl]butanamide.
| Compound Name | N-heptan-4-yl-N-[(3-methoxyphenyl)methyl]butanamide |
|---|---|
| PubChem CID | 71106716 |
| Molecular Formula | C19H31NO2 |
| Molecular Weight | 305.46 g/mol |
| Exact Mass | 305.24 |
| IUPAC Name | N-heptan-4-yl-N-[(3-methoxyphenyl)methyl]butanamide |
| SMILES | CCCC(=O)N(Cc1cccc(OC)c1)C(CCC)CCC |
| InChI | InChI=1S/C19H31NO2/c1-5-9-17(10-6-2)20(19(21)11-7-3)15-16-12-8-13-18(14-16)22-4/h8,12-14,17H,5-7,9-11,15H2,1-4H3 |
| InChIKey | QXTGWFNAWRFSKE-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.46 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |