C30H35NO3 — CID 11583824
4-[4-[[heptan-4-yl(3-phenylpropanoyl)amino]methyl]phenyl]benzoic acid (PubChem CID 11583824) has the molecular formula C30H35NO3 and a molecular weight of 457.61 g/mol. Its IUPAC name is 4-[4-[[heptan-4-yl(3-phenylpropanoyl)amino]methyl]phenyl]benzoic acid.
| Compound Name | 4-[4-[[heptan-4-yl(3-phenylpropanoyl)amino]methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 11583824 |
| Molecular Formula | C30H35NO3 |
| Molecular Weight | 457.61 g/mol |
| Exact Mass | 457.26 |
| IUPAC Name | 4-[4-[[heptan-4-yl(3-phenylpropanoyl)amino]methyl]phenyl]benzoic acid |
| SMILES | CCCC(CCC)N(Cc1ccc(-c2ccc(C(=O)O)cc2)cc1)C(=O)CCc1ccccc1 |
| InChI | InChI=1S/C30H35NO3/c1-3-8-28(9-4-2)31(29(32)21-14-23-10-6-5-7-11-23)22-24-12-15-25(16-13-24)26-17-19-27(20-18-26)30(33)34/h5-7,10-13,15-20,28H,3-4,8-9,14,21-22H2,1-2H3,(H,33,34) |
| InChIKey | XRABSEVWIZMWOB-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.61 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |