C23H30N2O2 — CID 132701689
2-[benzyl(3-phenylpropanoyl)amino]-N-butylpropanamide (PubChem CID 132701689) has the molecular formula C23H30N2O2 and a molecular weight of 366.50 g/mol. Its IUPAC name is 2-[benzyl(3-phenylpropanoyl)amino]-N-butylpropanamide.
| Compound Name | 2-[benzyl(3-phenylpropanoyl)amino]-N-butylpropanamide |
|---|---|
| PubChem CID | 132701689 |
| Molecular Formula | C23H30N2O2 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.23 |
| IUPAC Name | 2-[benzyl(3-phenylpropanoyl)amino]-N-butylpropanamide |
| SMILES | CCCCNC(=O)C(C)N(Cc1ccccc1)C(=O)CCc1ccccc1 |
| InChI | InChI=1S/C23H30N2O2/c1-3-4-17-24-23(27)19(2)25(18-21-13-9-6-10-14-21)22(26)16-15-20-11-7-5-8-12-20/h5-14,19H,3-4,15-18H2,1-2H3,(H,24,27) |
| InChIKey | VCQFLHLLBSYVGU-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|