C29H24NNaO3 — CID 68518284
sodium 4-phenyl-2-[[N-(3-phenylpropanoyl)anilino]methyl]benzoate (PubChem CID 68518284) has the molecular formula C29H24NNaO3 and a molecular weight of 457.51 g/mol. Its IUPAC name is sodium 4-phenyl-2-[[N-(3-phenylpropanoyl)anilino]methyl]benzoate.
| Compound Name | sodium 4-phenyl-2-[[N-(3-phenylpropanoyl)anilino]methyl]benzoate |
|---|---|
| PubChem CID | 68518284 |
| Molecular Formula | C29H24NNaO3 |
| Molecular Weight | 457.51 g/mol |
| Exact Mass | 457.17 |
| IUPAC Name | sodium 4-phenyl-2-[[N-(3-phenylpropanoyl)anilino]methyl]benzoate |
| SMILES | O=C([O-])c1ccc(-c2ccccc2)cc1CN(C(=O)CCc1ccccc1)c1ccccc1.[Na+] |
| InChI | InChI=1S/C29H25NO3.Na/c31-28(19-16-22-10-4-1-5-11-22)30(26-14-8-3-9-15-26)21-25-20-24(17-18-27(25)29(32)33)23-12-6-2-7-13-23;/h1-15,17-18,20H,16,19,21H2,(H,32,33);/q;+1/p-1 |
| InChIKey | CNBXGCOYRSIAJO-UHFFFAOYSA-M |
| XLogP | 1.89 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.51 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |