C17H16ClNO3 — CID 99819195
2-[(3-chlorobenzoyl)-(2-phenylethyl)amino]acetic acid (PubChem CID 99819195) has the molecular formula C17H16ClNO3 and a molecular weight of 317.77 g/mol. Its IUPAC name is 2-[(3-chlorobenzoyl)-(2-phenylethyl)amino]acetic acid.
| Compound Name | 2-[(3-chlorobenzoyl)-(2-phenylethyl)amino]acetic acid |
|---|---|
| PubChem CID | 99819195 |
| Molecular Formula | C17H16ClNO3 |
| Molecular Weight | 317.77 g/mol |
| Exact Mass | 317.08 |
| IUPAC Name | 2-[(3-chlorobenzoyl)-(2-phenylethyl)amino]acetic acid |
| SMILES | O=C(O)CN(CCc1ccccc1)C(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C17H16ClNO3/c18-15-8-4-7-14(11-15)17(22)19(12-16(20)21)10-9-13-5-2-1-3-6-13/h1-8,11H,9-10,12H2,(H,20,21) |
| InChIKey | HTEMDDHBXAPUJF-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.77 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |