C20H23NO6 — CID 100592353
2-[2-phenylethyl-(3,4,5-trimethoxybenzoyl)amino]acetic acid (PubChem CID 100592353) has the molecular formula C20H23NO6 and a molecular weight of 373.41 g/mol. Its IUPAC name is 2-[2-phenylethyl-(3,4,5-trimethoxybenzoyl)amino]acetic acid.
| Compound Name | 2-[2-phenylethyl-(3,4,5-trimethoxybenzoyl)amino]acetic acid |
|---|---|
| PubChem CID | 100592353 |
| Molecular Formula | C20H23NO6 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | 2-[2-phenylethyl-(3,4,5-trimethoxybenzoyl)amino]acetic acid |
| SMILES | COc1cc(C(=O)N(CCc2ccccc2)CC(=O)O)cc(OC)c1OC |
| InChI | InChI=1S/C20H23NO6/c1-25-16-11-15(12-17(26-2)19(16)27-3)20(24)21(13-18(22)23)10-9-14-7-5-4-6-8-14/h4-8,11-12H,9-10,13H2,1-3H3,(H,22,23) |
| InChIKey | DTZVPQQTJOSLDS-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |