C30H29NO2 — CID 68520532
4-[3-[[benzyl(3-phenylpropyl)amino]methyl]phenyl]benzoic acid (PubChem CID 68520532) has the molecular formula C30H29NO2 and a molecular weight of 435.57 g/mol. Its IUPAC name is 4-[3-[[benzyl(3-phenylpropyl)amino]methyl]phenyl]benzoic acid.
| Compound Name | 4-[3-[[benzyl(3-phenylpropyl)amino]methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 68520532 |
| Molecular Formula | C30H29NO2 |
| Molecular Weight | 435.57 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | 4-[3-[[benzyl(3-phenylpropyl)amino]methyl]phenyl]benzoic acid |
| SMILES | O=C(O)c1ccc(-c2cccc(CN(CCCc3ccccc3)Cc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C30H29NO2/c32-30(33)28-18-16-27(17-19-28)29-15-7-13-26(21-29)23-31(22-25-11-5-2-6-12-25)20-8-14-24-9-3-1-4-10-24/h1-7,9-13,15-19,21H,8,14,20,22-23H2,(H,32,33) |
| InChIKey | WBQQSCVJUOISSP-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.57 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |