C25H25NO3 — CID 142273250
N-hydroxy-4-[3-(6-oxo-6-phenylhexyl)phenyl]benzamide (PubChem CID 142273250) has the molecular formula C25H25NO3 and a molecular weight of 387.48 g/mol. Its IUPAC name is N-hydroxy-4-[3-(6-oxo-6-phenylhexyl)phenyl]benzamide.
| Compound Name | N-hydroxy-4-[3-(6-oxo-6-phenylhexyl)phenyl]benzamide |
|---|---|
| PubChem CID | 142273250 |
| Molecular Formula | C25H25NO3 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | N-hydroxy-4-[3-(6-oxo-6-phenylhexyl)phenyl]benzamide |
| SMILES | O=C(CCCCCc1cccc(-c2ccc(C(=O)NO)cc2)c1)c1ccccc1 |
| InChI | InChI=1S/C25H25NO3/c27-24(21-10-4-2-5-11-21)13-6-1-3-8-19-9-7-12-23(18-19)20-14-16-22(17-15-20)25(28)26-29/h2,4-5,7,9-12,14-18,29H,1,3,6,8,13H2,(H,26,28) |
| InChIKey | JYIXGBVGGLRFMB-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|