C25H23BrO3 — CID 15859124
2-[2-[4-(4-bromophenyl)phenyl]-2-oxoethyl]-5-phenylpentanoic acid (PubChem CID 15859124) has the molecular formula C25H23BrO3 and a molecular weight of 451.36 g/mol. Its IUPAC name is 2-[2-[4-(4-bromophenyl)phenyl]-2-oxoethyl]-5-phenylpentanoic acid.
| Compound Name | 2-[2-[4-(4-bromophenyl)phenyl]-2-oxoethyl]-5-phenylpentanoic acid |
|---|---|
| PubChem CID | 15859124 |
| Molecular Formula | C25H23BrO3 |
| Molecular Weight | 451.36 g/mol |
| Exact Mass | 450.08 |
| IUPAC Name | 2-[2-[4-(4-bromophenyl)phenyl]-2-oxoethyl]-5-phenylpentanoic acid |
| SMILES | O=C(CC(CCCc1ccccc1)C(=O)O)c1ccc(-c2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C25H23BrO3/c26-23-15-13-20(14-16-23)19-9-11-21(12-10-19)24(27)17-22(25(28)29)8-4-7-18-5-2-1-3-6-18/h1-3,5-6,9-16,22H,4,7-8,17H2,(H,28,29) |
| InChIKey | JROOKNZYNCGPOL-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.36 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |