C28H29NO4 — CID 143314276
4-[4-[4-(2-methylpropanoylamino)phenyl]phenyl]-4-oxo-2-(2-phenylethyl)butanoic acid (PubChem CID 143314276) has the molecular formula C28H29NO4 and a molecular weight of 443.54 g/mol. Its IUPAC name is 4-[4-[4-(2-methylpropanoylamino)phenyl]phenyl]-4-oxo-2-(2-phenylethyl)butanoic acid.
| Compound Name | 4-[4-[4-(2-methylpropanoylamino)phenyl]phenyl]-4-oxo-2-(2-phenylethyl)butanoic acid |
|---|---|
| PubChem CID | 143314276 |
| Molecular Formula | C28H29NO4 |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.21 |
| IUPAC Name | 4-[4-[4-(2-methylpropanoylamino)phenyl]phenyl]-4-oxo-2-(2-phenylethyl)butanoic acid |
| SMILES | CC(C)C(=O)Nc1ccc(-c2ccc(C(=O)CC(CCc3ccccc3)C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C28H29NO4/c1-19(2)27(31)29-25-16-14-22(15-17-25)21-10-12-23(13-11-21)26(30)18-24(28(32)33)9-8-20-6-4-3-5-7-20/h3-7,10-17,19,24H,8-9,18H2,1-2H3,(H,29,31)(H,32,33) |
| InChIKey | JYTGFYAOWARIKJ-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |