C27H28N2O4 — CID 143314043
2-[2-[4-[4-[(4-methylphenyl)carbamoylamino]phenyl]phenyl]-2-oxoethyl]pentanoic acid (PubChem CID 143314043) has the molecular formula C27H28N2O4 and a molecular weight of 444.53 g/mol. Its IUPAC name is 2-[2-[4-[4-[(4-methylphenyl)carbamoylamino]phenyl]phenyl]-2-oxoethyl]pentanoic acid.
| Compound Name | 2-[2-[4-[4-[(4-methylphenyl)carbamoylamino]phenyl]phenyl]-2-oxoethyl]pentanoic acid |
|---|---|
| PubChem CID | 143314043 |
| Molecular Formula | C27H28N2O4 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | 2-[2-[4-[4-[(4-methylphenyl)carbamoylamino]phenyl]phenyl]-2-oxoethyl]pentanoic acid |
| SMILES | CCCC(CC(=O)c1ccc(-c2ccc(NC(=O)Nc3ccc(C)cc3)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C27H28N2O4/c1-3-4-22(26(31)32)17-25(30)21-9-7-19(8-10-21)20-11-15-24(16-12-20)29-27(33)28-23-13-5-18(2)6-14-23/h5-16,22H,3-4,17H2,1-2H3,(H,31,32)(H2,28,29,33) |
| InChIKey | UJFMKAFYCAMNEK-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |