C19H21NO5P+ — CID 154067774
[6-amino-3-carboxy-2-hydroxy-6-oxo-1-(3-phenylphenyl)hexan-2-yl]-oxophosphanium (PubChem CID 154067774) has the molecular formula C19H21NO5P+ and a molecular weight of 374.35 g/mol. Its IUPAC name is [6-amino-3-carboxy-2-hydroxy-6-oxo-1-(3-phenylphenyl)hexan-2-yl]-oxophosphanium.
| Compound Name | [6-amino-3-carboxy-2-hydroxy-6-oxo-1-(3-phenylphenyl)hexan-2-yl]-oxophosphanium |
|---|---|
| PubChem CID | 154067774 |
| Molecular Formula | C19H21NO5P+ |
| Molecular Weight | 374.35 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | [6-amino-3-carboxy-2-hydroxy-6-oxo-1-(3-phenylphenyl)hexan-2-yl]-oxophosphanium |
| SMILES | NC(=O)CCC(C(=O)O)C(O)(Cc1cccc(-c2ccccc2)c1)[PH+]=O |
| InChI | InChI=1S/C19H20NO5P/c20-17(21)10-9-16(18(22)23)19(24,26-25)12-13-5-4-8-15(11-13)14-6-2-1-3-7-14/h1-8,11,16,24H,9-10,12H2,(H2,20,21)(H,22,23)/p+1 |
| InChIKey | BDZTVDQPKCEAJL-UHFFFAOYSA-O |
| XLogP | 2.58 |
| TPSA | 117.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.35 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|