C18H22N2O — CID 60862321
6-amino-6-(4-phenylphenyl)hexanamide (PubChem CID 60862321) has the molecular formula C18H22N2O and a molecular weight of 282.39 g/mol. Its IUPAC name is 6-amino-6-(4-phenylphenyl)hexanamide.
| Compound Name | 6-amino-6-(4-phenylphenyl)hexanamide |
|---|---|
| PubChem CID | 60862321 |
| Molecular Formula | C18H22N2O |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | 6-amino-6-(4-phenylphenyl)hexanamide |
| SMILES | NC(=O)CCCCC(N)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C18H22N2O/c19-17(8-4-5-9-18(20)21)16-12-10-15(11-13-16)14-6-2-1-3-7-14/h1-3,6-7,10-13,17H,4-5,8-9,19H2,(H2,20,21) |
| InChIKey | XPLRFUVCKSQHGH-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|