C19H24N4O2 — CID 170876356
3,5-diamino-4-(4-phenylphenyl)heptanediamide (PubChem CID 170876356) has the molecular formula C19H24N4O2 and a molecular weight of 340.43 g/mol. Its IUPAC name is 3,5-diamino-4-(4-phenylphenyl)heptanediamide.
| Compound Name | 3,5-diamino-4-(4-phenylphenyl)heptanediamide |
|---|---|
| PubChem CID | 170876356 |
| Molecular Formula | C19H24N4O2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | 3,5-diamino-4-(4-phenylphenyl)heptanediamide |
| SMILES | NC(=O)CC(N)C(c1ccc(-c2ccccc2)cc1)C(N)CC(N)=O |
| InChI | InChI=1S/C19H24N4O2/c20-15(10-17(22)24)19(16(21)11-18(23)25)14-8-6-13(7-9-14)12-4-2-1-3-5-12/h1-9,15-16,19H,10-11,20-21H2,(H2,22,24)(H2,23,25) |
| InChIKey | RORKCTTWACZMQB-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 138.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |