C15H21NO5P+ — CID 154066843
(8-amino-5-carboxy-4-hydroxy-8-oxo-1-phenyloctan-4-yl)-oxophosphanium (PubChem CID 154066843) has the molecular formula C15H21NO5P+ and a molecular weight of 326.31 g/mol. Its IUPAC name is (8-amino-5-carboxy-4-hydroxy-8-oxo-1-phenyloctan-4-yl)-oxophosphanium.
| Compound Name | (8-amino-5-carboxy-4-hydroxy-8-oxo-1-phenyloctan-4-yl)-oxophosphanium |
|---|---|
| PubChem CID | 154066843 |
| Molecular Formula | C15H21NO5P+ |
| Molecular Weight | 326.31 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | (8-amino-5-carboxy-4-hydroxy-8-oxo-1-phenyloctan-4-yl)-oxophosphanium |
| SMILES | NC(=O)CCC(C(=O)O)C(O)(CCCc1ccccc1)[PH+]=O |
| InChI | InChI=1S/C15H20NO5P/c16-13(17)9-8-12(14(18)19)15(20,22-21)10-4-7-11-5-2-1-3-6-11/h1-3,5-6,12,20H,4,7-10H2,(H2,16,17)(H,18,19)/p+1 |
| InChIKey | ZAVOBEAEKSZKTC-UHFFFAOYSA-O |
| XLogP | 1.69 |
| TPSA | 117.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.31 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|