About 4-phenylbenzaldehyde;2-phenylethanamine
4-phenylbenzaldehyde;2-phenylethanamine (PubChem CID 23291840) has the molecular formula C21H21NO
and a molecular weight of 303.41 g/mol. Its IUPAC name is 4-phenylbenzaldehyde;2-phenylethanamine.
Molecular Properties
| Compound Name | 4-phenylbenzaldehyde;2-phenylethanamine |
| PubChem CID | 23291840 |
| Molecular Formula | C21H21NO |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | 4-phenylbenzaldehyde;2-phenylethanamine |
| SMILES | NCCc1ccccc1.O=Cc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C13H10O.C8H11N/c14-10-11-6-8-13(9-7-11)12-4-2-1-3-5-12;9-7-6-8-4-2-1-3-5-8/h1-10H;1-5H,6-7,9H2 |
| InChIKey | ZKMRORPAIKWOPZ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-phenylbenzaldehyde;2-phenylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenylbenzaldehyde;2-phenylethanamine?
The IUPAC name of 4-phenylbenzaldehyde;2-phenylethanamine (CID 23291840) is 4-phenylbenzaldehyde;2-phenylethanamine.
What is the SMILES notation for 4-phenylbenzaldehyde;2-phenylethanamine?
The canonical SMILES for 4-phenylbenzaldehyde;2-phenylethanamine is NCCc1ccccc1.O=Cc1ccc(-c2ccccc2)cc1.
What is the InChIKey of 4-phenylbenzaldehyde;2-phenylethanamine?
The InChIKey is ZKMRORPAIKWOPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10O.C8H11N/c14-10-11-6-8-13(9-7-11)12-4-2-1-3-5-12;9-7-6-8-4-2-1-3-5-8/h1-10H;1-5H,6-7,9H2.
What are the key properties of 4-phenylbenzaldehyde;2-phenylethanamine?
4-phenylbenzaldehyde;2-phenylethanamine has a molecular weight of 303.41 g/mol, XLogP of 4.35, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenylbenzaldehyde;2-phenylethanamine is sourced from PubChem (CID 23291840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).