About 2-(3-chlorophenyl)ethanamine;4-phenoxybenzaldehyde
2-(3-chlorophenyl)ethanamine;4-phenoxybenzaldehyde (PubChem CID 23291749) has the molecular formula C21H20ClNO2
and a molecular weight of 353.85 g/mol. Its IUPAC name is 2-(3-chlorophenyl)ethanamine;4-phenoxybenzaldehyde.
Molecular Properties
| Compound Name | 2-(3-chlorophenyl)ethanamine;4-phenoxybenzaldehyde |
| PubChem CID | 23291749 |
| Molecular Formula | C21H20ClNO2 |
| Molecular Weight | 353.85 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | 2-(3-chlorophenyl)ethanamine;4-phenoxybenzaldehyde |
| SMILES | NCCc1cccc(Cl)c1.O=Cc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C13H10O2.C8H10ClN/c14-10-11-6-8-13(9-7-11)15-12-4-2-1-3-5-12;9-8-3-1-2-7(6-8)4-5-10/h1-10H;1-3,6H,4-5,10H2 |
| InChIKey | GGWQKJSIOGMNPS-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 353.85 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-(3-chlorophenyl)ethanamine;4-phenoxybenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-chlorophenyl)ethanamine;4-phenoxybenzaldehyde?
The IUPAC name of 2-(3-chlorophenyl)ethanamine;4-phenoxybenzaldehyde (CID 23291749) is 2-(3-chlorophenyl)ethanamine;4-phenoxybenzaldehyde.
What is the SMILES notation for 2-(3-chlorophenyl)ethanamine;4-phenoxybenzaldehyde?
The canonical SMILES for 2-(3-chlorophenyl)ethanamine;4-phenoxybenzaldehyde is NCCc1cccc(Cl)c1.O=Cc1ccc(Oc2ccccc2)cc1.
What is the InChIKey of 2-(3-chlorophenyl)ethanamine;4-phenoxybenzaldehyde?
The InChIKey is GGWQKJSIOGMNPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10O2.C8H10ClN/c14-10-11-6-8-13(9-7-11)15-12-4-2-1-3-5-12;9-8-3-1-2-7(6-8)4-5-10/h1-10H;1-3,6H,4-5,10H2.
What are the key properties of 2-(3-chlorophenyl)ethanamine;4-phenoxybenzaldehyde?
2-(3-chlorophenyl)ethanamine;4-phenoxybenzaldehyde has a molecular weight of 353.85 g/mol, XLogP of 5.13, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-chlorophenyl)ethanamine;4-phenoxybenzaldehyde is sourced from PubChem (CID 23291749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).