C39H33FO — CID 175542681
1,4-diphenylbenzene;2-fluorobenzaldehyde;2-phenylethylbenzene (PubChem CID 175542681) has the molecular formula C39H33FO and a molecular weight of 536.69 g/mol. Its IUPAC name is 1,4-diphenylbenzene;2-fluorobenzaldehyde;2-phenylethylbenzene.
| Compound Name | 1,4-diphenylbenzene;2-fluorobenzaldehyde;2-phenylethylbenzene |
|---|---|
| PubChem CID | 175542681 |
| Molecular Formula | C39H33FO |
| Molecular Weight | 536.69 g/mol |
| Exact Mass | 536.25 |
| IUPAC Name | 1,4-diphenylbenzene;2-fluorobenzaldehyde;2-phenylethylbenzene |
| SMILES | O=Cc1ccccc1F.c1ccc(-c2ccc(-c3ccccc3)cc2)cc1.c1ccc(CCc2ccccc2)cc1 |
| InChI | InChI=1S/C18H14.C14H14.C7H5FO/c1-3-7-15(8-4-1)17-11-13-18(14-12-17)16-9-5-2-6-10-16;1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14;8-7-4-2-1-3-6(7)5-9/h1-14H;1-10H,11-12H2;1-5H |
| InChIKey | IOPWQWSUVDSLQC-UHFFFAOYSA-N |
| XLogP | 10.13 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.69 |
| LogP ≤ 5 | 10.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|