C11H15FO3 — CID 88679380
1,1-dimethoxyethane;2-fluorobenzaldehyde (PubChem CID 88679380) has the molecular formula C11H15FO3 and a molecular weight of 214.24 g/mol. Its IUPAC name is 1,1-dimethoxyethane;2-fluorobenzaldehyde.
| Compound Name | 1,1-dimethoxyethane;2-fluorobenzaldehyde |
|---|---|
| PubChem CID | 88679380 |
| Molecular Formula | C11H15FO3 |
| Molecular Weight | 214.24 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | 1,1-dimethoxyethane;2-fluorobenzaldehyde |
| SMILES | COC(C)OC.O=Cc1ccccc1F |
| InChI | InChI=1S/C7H5FO.C4H10O2/c8-7-4-2-1-3-6(7)5-9;1-4(5-2)6-3/h1-5H;4H,1-3H3 |
| InChIKey | MCFNNTNCVWEBHD-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.24 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|