C12H19FN2O — CID 157438694
2-fluorobenzaldehyde;N,N',N'-trimethylethane-1,2-diamine (PubChem CID 157438694) has the molecular formula C12H19FN2O and a molecular weight of 226.30 g/mol. Its IUPAC name is 2-fluorobenzaldehyde;N,N',N'-trimethylethane-1,2-diamine.
| Compound Name | 2-fluorobenzaldehyde;N,N',N'-trimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 157438694 |
| Molecular Formula | C12H19FN2O |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.15 |
| IUPAC Name | 2-fluorobenzaldehyde;N,N',N'-trimethylethane-1,2-diamine |
| SMILES | CNCCN(C)C.O=Cc1ccccc1F |
| InChI | InChI=1S/C7H5FO.C5H14N2/c8-7-4-2-1-3-6(7)5-9;1-6-4-5-7(2)3/h1-5H;6H,4-5H2,1-3H3 |
| InChIKey | BRKHEPXELLKNCC-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|