C11H30N2 — CID 176717346
propane;N,N',N'-trimethylethane-1,2-diamine (PubChem CID 176717346) has the molecular formula C11H30N2 and a molecular weight of 190.37 g/mol. Its IUPAC name is propane;N,N',N'-trimethylethane-1,2-diamine.
| Compound Name | propane;N,N',N'-trimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 176717346 |
| Molecular Formula | C11H30N2 |
| Molecular Weight | 190.37 g/mol |
| Exact Mass | 190.24 |
| IUPAC Name | propane;N,N',N'-trimethylethane-1,2-diamine |
| SMILES | CCC.CCC.CNCCN(C)C |
| InChI | InChI=1S/C5H14N2.2C3H8/c1-6-4-5-7(2)3;2*1-3-2/h6H,4-5H2,1-3H3;2*3H2,1-2H3 |
| InChIKey | XMBLJZDRAPCWFC-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.37 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |